Products 960589-48-4
CAS 960589-48-4 is the registry number for 1-Chloro-8,9-dihydrothieno[3,2-f]quinazoline 7,7-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-8,9-dihydrothieno[3,2-f]quinazoline 7,7-dioxide (CAS 960589-48-4) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 1-chloro-8,9-dihydrothieno[3,2-f]quinazoline 7,7-dioxide. InChIKey: TXQKYKUWJWFLKJ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 1-chloro-8,9-dihydrothieno[3,2-f]quinazoline 7,7-dioxide |
| InChIKey | TXQKYKUWJWFLKJ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C1C3=C(C=C2)N=CN=C3Cl |
Computed by PubChem (NCBI)