CAS 206555-62-6 is the registry number for 2-Amino-4-(4-chlorophenyl)-5-thiazolecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-amino-4-(4-chlorophenyl)-1,3-thiazole-5-carboxylic acid (CAS 206555-62-6) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 2-amino-4-(4-chlorophenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: HHXJHHCEEYFAPL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 2-amino-4-(4-chlorophenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | HHXJHHCEEYFAPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(SC(=N2)N)C(=O)O)Cl |
Computed by PubChem (NCBI)