CAS 923249-02-9 appears in our catalog under these names: 2-Amino-5-(4-chlorophenyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-Amino-5-(4-chlorophenyl)-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
2-amino-5-(4-chlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 923249-02-9) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 2-amino-5-(4-chlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: WSUPUSJWNYAWCU-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 2-amino-5-(4-chlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | WSUPUSJWNYAWCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=C(S2)N)C(=O)O)Cl |
Computed by PubChem (NCBI)