CAS 89960-36-1 appears in our catalog under these names: 1-Benzyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 98%, 1-Benzyl-2-oxo-1,2-dihydro-3-pyridinecarboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
1-benzyl-2-oxopyridine-3-carboxylic acid (CAS 89960-36-1) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 1-benzyl-2-oxopyridine-3-carboxylic acid. InChIKey: JMUXBAQFXTYJBB-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 1-benzyl-2-oxopyridine-3-carboxylic acid |
| InChIKey | JMUXBAQFXTYJBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)