CAS 89981-37-3 is the registry number for 2-Chloro-N-(2-sulfamoylphenyl)acetamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-chloro-N-(2-sulfamoylphenyl)acetamide (CAS 89981-37-3) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: 2-chloro-N-(2-sulfamoylphenyl)acetamide. InChIKey: DHJOHYDADNBTSW-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3S |
|---|---|
| Molecular weight | 248.69 g/mol |
| IUPAC name | 2-chloro-N-(2-sulfamoylphenyl)acetamide |
| InChIKey | DHJOHYDADNBTSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCl)S(=O)(=O)N |
Computed by PubChem (NCBI)