CAS 90418-63-6 is the registry number for Cinnoline-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Cinnoline-3-carboxylic acid (CAS 90418-63-6) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: cinnoline-3-carboxylic acid. InChIKey: BLFJCJKTSCOLEY-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | cinnoline-3-carboxylic acid |
| InChIKey | BLFJCJKTSCOLEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)