Products 90610-24-5
CAS 90610-24-5 appears in our catalog under these names: 5-Aminomethyl-salicylic acid methyl este, r hydrochloride, 5 g, Methyl 5-(aminomethyl)-2-hydroxybenzoate hydrochloride, 95%, 5-Aminomethyl-salicylic acid methyl ester hydrochloride, 5-Aminomethyl-salicylic Acid Methyl Ester Hydrochloride, >95% (HPLC), 5-Aminomethyl-salicylic acid methyl este, r hydrochloride, 250 mg. Offered by: Roth, AmBeed, Biosynth, TRC. Available pack sizes: 5g, 10g, 1g, 100mg, 500mg, 250mg.
Methyl 5-(aminomethyl)-2-hydroxybenzoate;hydrochloride (CAS 90610-24-5) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: methyl 5-(aminomethyl)-2-hydroxybenzoate;hydrochloride. InChIKey: QKMAXZJEOQYXNZ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | methyl 5-(aminomethyl)-2-hydroxybenzoate;hydrochloride |
| InChIKey | QKMAXZJEOQYXNZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)CN)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl 5-(aminomethyl)-2-hydroxybenzoate hydrochloride, 5-Aminomethyl-salicylic acid methyl ester Hcl, 5-Aminomethyl-salicylic acid methyl ester hydrochloride, Methyl5-(aminomethyl)-2-hydroxybenzoatehydrochloride, methyl 5-(aminomethyl)-2-hydroxybenzoate;hydrochloride, 5-Aminomethylsalicylic acid methyl ester, 5-aminomethyl-2-hydroxybenzoic acid methyl ester, 5-Aminomethylsalicylic acid methyl ester hydrochloride, methyl 5-(aminomethyl)-2-hydroxy-benzoate;hydrochloride, 5-(Aminomethyl)-2-hydroxy-benzoic acid methyl ester hydrochloride