Products 90962-63-3
CAS 90962-63-3 appears in our catalog under these names: Penicillin Impurity 8, Isopenillic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
2-benzyl-1-[(1S)-1-carboxy-2-methyl-2-sulfanylpropyl]imidazole-4-carboxylic acid (CAS 90962-63-3) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: 2-benzyl-1-[(1S)-1-carboxy-2-methyl-2-sulfanylpropyl]imidazole-4-carboxylic acid. InChIKey: QLTUFLACBYWAET-ZDUSSCGKSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2-benzyl-1-[(1S)-1-carboxy-2-methyl-2-sulfanylpropyl]imidazole-4-carboxylic acid |
| InChIKey | QLTUFLACBYWAET-ZDUSSCGKSA-N |
| SMILES | CC(C)([C@H](C(=O)O)N1C=C(N=C1CC2=CC=CC=C2)C(=O)O)S |
Computed by PubChem (NCBI)