Products 910303-54-7
CAS 910303-54-7 appears in our catalog under these names: Celecoxib Impurity 24, Celecoxib Impurity E. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-1,1,1-trifluoro-4-hydroxy-4-(4-methylphenyl)but-3-en-2-one (CAS 910303-54-7) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: (Z)-1,1,1-trifluoro-4-hydroxy-4-(4-methylphenyl)but-3-en-2-one. InChIKey: RHQUXXUCBVNJCP-TWGQIWQCSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | (Z)-1,1,1-trifluoro-4-hydroxy-4-(4-methylphenyl)but-3-en-2-one |
| InChIKey | RHQUXXUCBVNJCP-TWGQIWQCSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=C/C(=O)C(F)(F)F)/O |
Computed by PubChem (NCBI)