CAS 91418-45-0 appears in our catalog under these names: 3-(4-Hydroxy-3-methoxybenzylidene)pentane-2,4-dione, 90%, 90%, 3-(4-Hydroxy-3-methoxybenzylidene)pentane-2,4-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-[(4-hydroxy-3-methoxyphenyl)methylidene]pentane-2,4-dione (CAS 91418-45-0) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 3-[(4-hydroxy-3-methoxyphenyl)methylidene]pentane-2,4-dione. InChIKey: XMAWAPAJKQHUHU-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 3-[(4-hydroxy-3-methoxyphenyl)methylidene]pentane-2,4-dione |
| InChIKey | XMAWAPAJKQHUHU-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=CC1=CC(=C(C=C1)O)OC)C(=O)C |
Computed by PubChem (NCBI)