Products 91420-99-4
CAS 91420-99-4 appears in our catalog under these names: 3–Formyl–4–methoxybenzoic Acid, 3-Formyl-4-methoxybenzoic acid, 3-Formyl-4-methoxybenzoic acid, 95%, 3-Formyl-4-methoxybenzoic acid, 98%, 3-Formyl-4-methoxybenzoic acid 98%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 5g, 100mg, 500mg, 2.5g.
3-formyl-4-methoxybenzoic acid (CAS 91420-99-4) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 3-formyl-4-methoxybenzoic acid. InChIKey: LAQPQIRPQCMEHG-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-formyl-4-methoxybenzoic acid |
| InChIKey | LAQPQIRPQCMEHG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)C=O |
Computed by PubChem (NCBI)