Products 914776-02-6
CAS 914776-02-6 is the registry number for 2-Methoxy-4-((trifluoromethyl)sulfonyl)aniline, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
2-methoxy-4-(trifluoromethylsulfonyl)aniline (CAS 914776-02-6) is a chemical compound with the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. IUPAC name: 2-methoxy-4-(trifluoromethylsulfonyl)aniline. InChIKey: XWKBEUXKELBHAU-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3S |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 2-methoxy-4-(trifluoromethylsulfonyl)aniline |
| InChIKey | XWKBEUXKELBHAU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)S(=O)(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)