CAS 91520-81-9 appears in our catalog under these names: 4-Methyl-1-hydrazinophthalizine Hydrochloride, 4-Methyl-1-hydrazino-phthalazine HCl. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg.
(4-methylphthalazin-1-yl)hydrazine;hydrochloride (CAS 91520-81-9) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: (4-methylphthalazin-1-yl)hydrazine;hydrochloride. InChIKey: LDKCZGWQXZVGNN-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | (4-methylphthalazin-1-yl)hydrazine;hydrochloride |
| InChIKey | LDKCZGWQXZVGNN-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(C2=CC=CC=C12)NN.Cl |
Computed by PubChem (NCBI)