CAS 91828-74-9 appears in our catalog under these names: 2-(2,4-dinitrophenyl)ethanamine, Mirabegron Impurity 26. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2,4-dinitrophenyl)ethanamine (CAS 91828-74-9) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 211.17 g/mol. IUPAC name: 2-(2,4-dinitrophenyl)ethanamine. InChIKey: YKMOOBLAWBCXFX-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-(2,4-dinitrophenyl)ethanamine |
| InChIKey | YKMOOBLAWBCXFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CCN |
Computed by PubChem (NCBI)