CAS 92339-07-6 appears in our catalog under these names: 2,3,5,6-Tetrafluoro-1,4-benzenedimethanol, 2,3,5,6–Tetrafluoro–1,4–benzenedimethanol, 2,3,5,6-Tetrafluoro-1,4-benzenedimethanol, >97.0%(GC), 2,3,5,6-Tetrafluoro-1,4-benzenedimethanol 97%, 2,3,5,6-Tetrafluoro-1,4-benzenedimethanol, 98%, 98%. Offered by: Dr. Ehrenstorfer, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 100g, 25g, 5g, 500g, 1g, 10g.
[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methanol (CAS 92339-07-6) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: [2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methanol. InChIKey: SDHKGYDQOGCLQM-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | [2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methanol |
| InChIKey | SDHKGYDQOGCLQM-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)CO)F)F)O |
Computed by PubChem (NCBI)