Products 927801-67-0
CAS 927801-67-0 is the registry number for 2-Methyl-(1,3)thiazolo(5,4-b)pyridine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-[1,3]thiazolo[5,4-b]pyridine-6-carboxylic acid (CAS 927801-67-0) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-methyl-[1,3]thiazolo[5,4-b]pyridine-6-carboxylic acid. InChIKey: ZMOVNBGEVRHQBL-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-methyl-[1,3]thiazolo[5,4-b]pyridine-6-carboxylic acid |
| InChIKey | ZMOVNBGEVRHQBL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)N=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)