CAS 929249-82-1 is the registry number for 2-chloro-1-(2,3-difluorophenyl)ethanone. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(2,3-difluorophenyl)ethanone (CAS 929249-82-1) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 2-chloro-1-(2,3-difluorophenyl)ethanone. InChIKey: MDIRNNQCNIDIIJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 2-chloro-1-(2,3-difluorophenyl)ethanone |
| InChIKey | MDIRNNQCNIDIIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(=O)CCl |
Computed by PubChem (NCBI)