CAS 93-85-6 appears in our catalog under these names: 2–Aminobenzothiazole–6–carboxylic acid, 2-Aminobenzothiazole-6-carboxylic acid, 95% , 6-Benzothiazolecarboxylic acid, 2-amino-, 97%, 97%, 2-Amino-benzothiazole-6-carboxylic acid, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
2-amino-1,3-benzothiazole-6-carboxylic acid (CAS 93-85-6) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-amino-1,3-benzothiazole-6-carboxylic acid. InChIKey: ZEAKWWWXCZMODH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-amino-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | ZEAKWWWXCZMODH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)SC(=N2)N |
Computed by PubChem (NCBI)