CAS 93427-22-6 appears in our catalog under these names: 2-(3,5-Dimethoxy-2-nitrophenyl)acetonitrile, 95%, 2-(3,5-Dimethoxy-2-nitrophenyl)acetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3,5-dimethoxy-2-nitrophenyl)acetonitrile (CAS 93427-22-6) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 2-(3,5-dimethoxy-2-nitrophenyl)acetonitrile. InChIKey: STAGKOATYXUYMV-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 2-(3,5-dimethoxy-2-nitrophenyl)acetonitrile |
| InChIKey | STAGKOATYXUYMV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)[N+](=O)[O-])CC#N |
Computed by PubChem (NCBI)