Products 937620-73-0
CAS 937620-73-0 is the registry number for 2-(Chloromethyl)-5-(3-methylfuran-2-yl)-1,3,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(chloromethyl)-5-(3-methylfuran-2-yl)-1,3,4-oxadiazole (CAS 937620-73-0) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 2-(chloromethyl)-5-(3-methylfuran-2-yl)-1,3,4-oxadiazole. InChIKey: YDEMDZSPZVWAOH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(3-methylfuran-2-yl)-1,3,4-oxadiazole |
| InChIKey | YDEMDZSPZVWAOH-UHFFFAOYSA-N |
| SMILES | CC1=C(OC=C1)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)