CAS 937654-30-3 is the registry number for 1-(3-(Thiophen-2-yl)-1,2,4-oxadiazol-5-yl)ethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethanamine (CAS 937654-30-3) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: 1-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethanamine. InChIKey: PRPBJYGHBVQGHP-UHFFFAOYSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 1-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethanamine |
| InChIKey | PRPBJYGHBVQGHP-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C2=CC=CS2)N |
Computed by PubChem (NCBI)