CAS 938118-64-0 appears in our catalog under these names: 3-(3,5-Dichlorophenoxy)propanoic acid, 95%, 3-(3,5-Dichlorophenoxy)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(3,5-dichlorophenoxy)propanoic acid (CAS 938118-64-0) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 3-(3,5-dichlorophenoxy)propanoic acid. InChIKey: KCXNBTVQFJREHK-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 3-(3,5-dichlorophenoxy)propanoic acid |
| InChIKey | KCXNBTVQFJREHK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)OCCC(=O)O |
Computed by PubChem (NCBI)