CAS 93951-90-7 appears in our catalog under these names: 2,6-Dinitrotoluene-alpha,alpha,alpha-d3, 98 atom % D, min 98% Chemical Purity, 2,6-DINITROTOLUENE-A,A,A-D3, 98 ATOM % &. Offered by: CDN, Sigma-Aldrich. Available pack sizes: 0,5g, 0,25g, 100MG.
1,3-dinitro-2-(trideuteriomethyl)benzene (CAS 93951-90-7) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 185.15 g/mol. IUPAC name: 1,3-dinitro-2-(trideuteriomethyl)benzene. InChIKey: XTRDKALNCIHHNI-FIBGUPNXSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 1,3-dinitro-2-(trideuteriomethyl)benzene |
| InChIKey | XTRDKALNCIHHNI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC=C1[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)