Products 94294-09-4

CAS 94294-09-4 appears in our catalog under these names: 2,4-Dichloro-6-methoxybenzoic acid, 98%, 98%, 2,4-Dichloro-6-methoxybenzoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,4-dichloro-6-methoxybenzoic acid (CAS 94294-09-4) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2,4-dichloro-6-methoxybenzoic acid. InChIKey: SZLIBSRWMLMNIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O3
Molecular weight221.03 g/mol
IUPAC name2,4-dichloro-6-methoxybenzoic acid
InChIKeySZLIBSRWMLMNIJ-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)