Products 944580-80-7
CAS 944580-80-7 is the registry number for 5-(Trifluoromethyl)imidazo[1,2-a]pyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 944580-80-7) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 5-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: BUPPVYBGHPQGKZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | BUPPVYBGHPQGKZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C(=C1)C(F)(F)F |
Computed by PubChem (NCBI)