Products 944709-39-1
CAS 944709-39-1 is the registry number for 1-(2-Chloroethyl)-1H-pyrrole-2,3-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
1-(2-chloroethyl)pyrrole-2,3-dicarboxylic acid (CAS 944709-39-1) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 1-(2-chloroethyl)pyrrole-2,3-dicarboxylic acid. InChIKey: FLMNQXCXLLLKCQ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 1-(2-chloroethyl)pyrrole-2,3-dicarboxylic acid |
| InChIKey | FLMNQXCXLLLKCQ-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1C(=O)O)C(=O)O)CCCl |
Computed by PubChem (NCBI)