CAS 944898-64-0 appears in our catalog under these names: 7-Fluoro-1,3-benzoxazole-2-carboxylic acid, 95%, 95%, 7-FLUORO-1,3-BENZOXAZOLE-2-CARBOXYLIC ACID, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
7-fluoro-1,3-benzoxazole-2-carboxylic acid (CAS 944898-64-0) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 7-fluoro-1,3-benzoxazole-2-carboxylic acid. InChIKey: AFIQTMKVSIOGHK-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 7-fluoro-1,3-benzoxazole-2-carboxylic acid |
| InChIKey | AFIQTMKVSIOGHK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)OC(=N2)C(=O)O |
Computed by PubChem (NCBI)