CAS 944907-37-3 appears in our catalog under these names: 5-Fluorobenzo(d)oxazole-2-carbaldehyde, 95+%, 5-Fluoro-1,3-benzoxazole-2-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-fluoro-1,3-benzoxazole-2-carbaldehyde (CAS 944907-37-3) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 5-fluoro-1,3-benzoxazole-2-carbaldehyde. InChIKey: LKHQUCGGIXTEFX-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 5-fluoro-1,3-benzoxazole-2-carbaldehyde |
| InChIKey | LKHQUCGGIXTEFX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N=C(O2)C=O |
Computed by PubChem (NCBI)