CAS 945004-00-2 is the registry number for Methyl 3,4-dichloro-5-methoxybenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3,4-dichloro-5-methoxybenzoate (CAS 945004-00-2) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: methyl 3,4-dichloro-5-methoxybenzoate. InChIKey: MQHJSECPEIUQBC-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | methyl 3,4-dichloro-5-methoxybenzoate |
| InChIKey | MQHJSECPEIUQBC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)OC)Cl)Cl |
Computed by PubChem (NCBI)