Products 945473-82-5
CAS 945473-82-5 appears in our catalog under these names: 3-((Pyridin-3-yl)methoxy)benzoic acid, 3-(Pyridin-3-ylmethoxy)benzoic acid, 95%, 95%, 3-[(pyridin-3-yl)methoxy]benzoic acid, 95+%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-(pyridin-3-ylmethoxy)benzoic acid (CAS 945473-82-5) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-(pyridin-3-ylmethoxy)benzoic acid. InChIKey: MOEOUPZPWRMGFV-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-(pyridin-3-ylmethoxy)benzoic acid |
| InChIKey | MOEOUPZPWRMGFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC2=CN=CC=C2)C(=O)O |
Computed by PubChem (NCBI)