CAS 946725-04-8 is the registry number for 3-(Benzo[d][1,3]dioxol-5-ylmethoxy)benzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,3-benzodioxol-5-ylmethoxy)benzaldehyde (CAS 946725-04-8) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-ylmethoxy)benzaldehyde. InChIKey: ZUQSFWMTSCJVGJ-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-ylmethoxy)benzaldehyde |
| InChIKey | ZUQSFWMTSCJVGJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)COC3=CC=CC(=C3)C=O |
Computed by PubChem (NCBI)