CAS 947547-41-3 is the registry number for (3-Ethyl-4-methoxyphenyl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
(3-ethyl-4-methoxyphenyl)boronic acid (CAS 947547-41-3) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (3-ethyl-4-methoxyphenyl)boronic acid. InChIKey: OMAZGRPOBAPVHB-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (3-ethyl-4-methoxyphenyl)boronic acid |
| InChIKey | OMAZGRPOBAPVHB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)CC)(O)O |
Computed by PubChem (NCBI)