Products 951-97-3
CAS 951-97-3 is the registry number for 2-Acetamido-4-nitrobenzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
2-acetamido-4-nitrobenzoic acid (CAS 951-97-3) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 2-acetamido-4-nitrobenzoic acid. InChIKey: OAYHLMVCNPUEPI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 2-acetamido-4-nitrobenzoic acid |
| InChIKey | OAYHLMVCNPUEPI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(Acetylamino)-4-nitrobenzoic acid, Benzoic acid, 2-(acetylamino)-4-nitro-, Anthranilic acid, N-acetyl-4-nitro-, Anthranilic acid, N-acetyl-4-nitro-(8CI), 2-Acetamido-4-nitrobenzoic acid, 2-acetylamino-4-nitrobenzoic acid, 2-Acetylamino-4-nitro-benzoic acid, 4-nitro-N-acetyl-anthranilic acid, Oprea1_794740, 2-acetamido-4-nitro-benzoic acid