Products 617-10-7

CAS 617-10-7 is the registry number for (3-Nitro-benzoylamino)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[(3-nitrobenzoyl)amino]acetic acid (CAS 617-10-7) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 2-[(3-nitrobenzoyl)amino]acetic acid. InChIKey: GSVGZXWNWOCWGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2O5
Molecular weight224.17 g/mol
IUPAC name2-[(3-nitrobenzoyl)amino]acetic acid
InChIKeyGSVGZXWNWOCWGJ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NCC(=O)O

Computed by PubChem (NCBI)