Products 50826-00-1
CAS 50826-00-1 is the registry number for Methyl 3-carbamoyl-5-nitrobenzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Methyl 3-carbamoyl-5-nitrobenzoate (CAS 50826-00-1) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: methyl 3-carbamoyl-5-nitrobenzoate. InChIKey: FUXUMOOJLAEGAX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | methyl 3-carbamoyl-5-nitrobenzoate |
| InChIKey | FUXUMOOJLAEGAX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)