Products 2645-07-0
CAS 2645-07-0 appears in our catalog under these names: 4-Nitrohippuric acid, 95%, 4–Nitrohippuric Acid, 4-Nitrohippuric acid, 4-NO2-Hippuric acid 98%, 2-(4-Nitrobenzamido)acetic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100g, 25g, 10g, 50g, 100 g.
2-[(4-nitrobenzoyl)amino]acetic acid (CAS 2645-07-0) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 2-[(4-nitrobenzoyl)amino]acetic acid. InChIKey: XCMUCRMMVDSVEL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 2-[(4-nitrobenzoyl)amino]acetic acid |
| InChIKey | XCMUCRMMVDSVEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)