Products 1954-97-8
CAS 1954-97-8 is the registry number for N-Methyl-5-nitro-isophthalamic Acid. Offered by: TRC. Available pack sizes: 2,5g.
3-(methylcarbamoyl)-5-nitrobenzoic acid (CAS 1954-97-8) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 3-(methylcarbamoyl)-5-nitrobenzoic acid. InChIKey: GVKLFFIPALKQFM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 3-(methylcarbamoyl)-5-nitrobenzoic acid |
| InChIKey | GVKLFFIPALKQFM-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-[(Methylamino)carbonyl]-5-nitrobenzoic acid, 3-((Methylamino)carbonyl)-5-nitrobenzoic acid, 3-(methylcarbamoyl)-5-nitrobenzoic acid, N-Methyl-5-nitro-isophthalamic Acid, GVKLFFIPALKQFM-UHFFFAOYSA-N, Benzoic acid, 3-[(methylamino)carbonyl]-5-nitro-, 3-[Hydroxy(methylimino)methyl]-5-nitrobenzoic acid