Products 1255717-69-1

CAS 1255717-69-1 is the registry number for 2,3-Dioxo-1,2,3,4-tetrahydro-6-quinoxalinecarboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

2,3-dioxo-1,4-dihydroquinoxaline-6-carboxylic acid;hydrate (CAS 1255717-69-1) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 2,3-dioxo-1,4-dihydroquinoxaline-6-carboxylic acid;hydrate. InChIKey: SNNRHFUJGUGCQF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2O5
Molecular weight224.17 g/mol
IUPAC name2,3-dioxo-1,4-dihydroquinoxaline-6-carboxylic acid;hydrate
InChIKeySNNRHFUJGUGCQF-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(=O)O)NC(=O)C(=O)N2.O

Computed by PubChem (NCBI)