CAS 21573-29-5 appears in our catalog under these names: 4-(Acetylamino)-2-nitrobenzoic acid, 95%, 4-Acetamido-2-nitrobenzoic acid, 97%, 4-(Acetylamino)-2-nitrobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 500mg, 250mg, 1000mg, 2000mg, 5000mg.
4-acetamido-2-nitrobenzoic acid (CAS 21573-29-5) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 4-acetamido-2-nitrobenzoic acid. InChIKey: DQKOLPCSICJNQJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 4-acetamido-2-nitrobenzoic acid |
| InChIKey | DQKOLPCSICJNQJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)