CAS 20132-75-6 is the registry number for Methyl 4-carbamoyl-2-nitrobenzoate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-carbamoyl-2-nitrobenzoate (CAS 20132-75-6) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: methyl 4-carbamoyl-2-nitrobenzoate. InChIKey: OYZKIZQJLPADLO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | methyl 4-carbamoyl-2-nitrobenzoate |
| InChIKey | OYZKIZQJLPADLO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)