CAS 951905-14-9 appears in our catalog under these names: 4-Chloro-2-methyl-6-(propan-2-yloxy)quinoline, 95%, 4-Chloro-2-methyl-6-(propan-2-yloxy)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-chloro-2-methyl-6-propan-2-yloxyquinoline (CAS 951905-14-9) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 4-chloro-2-methyl-6-propan-2-yloxyquinoline. InChIKey: LSUCFUOMBWNQKW-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 4-chloro-2-methyl-6-propan-2-yloxyquinoline |
| InChIKey | LSUCFUOMBWNQKW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)OC(C)C)Cl |
Computed by PubChem (NCBI)