Products 952480-00-1

CAS 952480-00-1 is the registry number for Methyl 2,5-difluoro-3-formylbenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,5-difluoro-3-formylbenzoate (CAS 952480-00-1) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: methyl 2,5-difluoro-3-formylbenzoate. InChIKey: NBISMVWFNSDEKW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F2O3
Molecular weight200.14 g/mol
IUPAC namemethyl 2,5-difluoro-3-formylbenzoate
InChIKeyNBISMVWFNSDEKW-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC(=C1F)C=O)F

Computed by PubChem (NCBI)