CAS 952480-00-1 is the registry number for Methyl 2,5-difluoro-3-formylbenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2,5-difluoro-3-formylbenzoate (CAS 952480-00-1) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: methyl 2,5-difluoro-3-formylbenzoate. InChIKey: NBISMVWFNSDEKW-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | methyl 2,5-difluoro-3-formylbenzoate |
| InChIKey | NBISMVWFNSDEKW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1F)C=O)F |
Computed by PubChem (NCBI)