CAS 954230-95-6 is the registry number for 5-(Thiophen-2-yl)-1,2-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-thiophen-2-yl-1,2-oxazole-4-carboxylic acid (CAS 954230-95-6) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 5-thiophen-2-yl-1,2-oxazole-4-carboxylic acid. InChIKey: ASSDHSCKHFBLII-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-thiophen-2-yl-1,2-oxazole-4-carboxylic acid |
| InChIKey | ASSDHSCKHFBLII-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=C(C=NO2)C(=O)O |
Computed by PubChem (NCBI)