Products 959058-59-4
CAS 959058-59-4 appears in our catalog under these names: 7-Bromo-4-methoxy-2，3-dihydro-1H-inden-1-one, 95%, 95%, 7-Bromo-4-methoxy-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-bromo-4-methoxy-2,3-dihydroinden-1-one (CAS 959058-59-4) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-4-methoxy-2,3-dihydroinden-1-one. InChIKey: XSQABQQBQNMZDZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-4-methoxy-2,3-dihydroinden-1-one |
| InChIKey | XSQABQQBQNMZDZ-UHFFFAOYSA-N |
| SMILES | COC1=C2CCC(=O)C2=C(C=C1)Br |
Computed by PubChem (NCBI)