Products 95970-20-0
CAS 95970-20-0 is the registry number for 1,2-dibromo-3-methoxy-5-nitrobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2-dibromo-3-methoxy-5-nitrobenzene (CAS 95970-20-0) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: 1,2-dibromo-3-methoxy-5-nitrobenzene. InChIKey: DWYMLLKXKWHAIC-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | 1,2-dibromo-3-methoxy-5-nitrobenzene |
| InChIKey | DWYMLLKXKWHAIC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)[N+](=O)[O-])Br)Br |
Computed by PubChem (NCBI)