CAS 960535-43-7 appears in our catalog under these names: 2,6-Dichloro-(1,3)thiazolo(4,5-b)pyridine, 95%, 2,6-Dichloro-(1,3)thiazolo(4,5-b)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,6-dichloro-[1,3]thiazolo[4,5-b]pyridine (CAS 960535-43-7) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 2,6-dichloro-[1,3]thiazolo[4,5-b]pyridine. InChIKey: NSOMSBHAMKHHNR-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 2,6-dichloro-[1,3]thiazolo[4,5-b]pyridine |
| InChIKey | NSOMSBHAMKHHNR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1SC(=N2)Cl)Cl |
Computed by PubChem (NCBI)