Products 96385-49-8
CAS 96385-49-8 appears in our catalog under these names: 4-Chlorophthalamide, 95+%, 4-Chlorophthalamide, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chlorobenzene-1,2-dicarboxamide (CAS 96385-49-8) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 4-chlorobenzene-1,2-dicarboxamide. InChIKey: YGIFSVAYJLFDLC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 4-chlorobenzene-1,2-dicarboxamide |
| InChIKey | YGIFSVAYJLFDLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)