CAS 98556-60-6 appears in our catalog under these names: 5-Iodoisoindoline-1,3-dione, 95%, 95%, 5-Iodo-1H-isoindole-1,3(2H)-dione, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-iodoisoindole-1,3-dione (CAS 98556-60-6) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 5-iodoisoindole-1,3-dione. InChIKey: UOQFQHVMHWWNDM-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 5-iodoisoindole-1,3-dione |
| InChIKey | UOQFQHVMHWWNDM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=O)NC2=O |
Computed by PubChem (NCBI)