CAS 98946-95-3 appears in our catalog under these names: 4-Bromo-6-methoxy-2,3-dihydro-1H-inden-1-one, 97%, 4-Bromo-6-methoxy-2,3-dihydro-1H-inden-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,05g, 0,25g, 0,1g, 0,5g.
4-bromo-6-methoxy-2,3-dihydroinden-1-one (CAS 98946-95-3) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 4-bromo-6-methoxy-2,3-dihydroinden-1-one. InChIKey: VIDXHBZUGHZQPG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 4-bromo-6-methoxy-2,3-dihydroinden-1-one |
| InChIKey | VIDXHBZUGHZQPG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCC2=O)C(=C1)Br |
Computed by PubChem (NCBI)