CAS 99450-55-2 is the registry number for Methyl 5-amino-2-methoxybenzoate hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Methyl 5-amino-2-methoxybenzoate;hydrochloride (CAS 99450-55-2) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: methyl 5-amino-2-methoxybenzoate;hydrochloride. InChIKey: IKQYVJKSCZFDCX-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | methyl 5-amino-2-methoxybenzoate;hydrochloride |
| InChIKey | IKQYVJKSCZFDCX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)