Products 99450-55-2

CAS 99450-55-2 is the registry number for Methyl 5-amino-2-methoxybenzoate hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-amino-2-methoxybenzoate;hydrochloride (CAS 99450-55-2) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: methyl 5-amino-2-methoxybenzoate;hydrochloride. InChIKey: IKQYVJKSCZFDCX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO3
Molecular weight217.65 g/mol
IUPAC namemethyl 5-amino-2-methoxybenzoate;hydrochloride
InChIKeyIKQYVJKSCZFDCX-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)N)C(=O)OC.Cl

Computed by PubChem (NCBI)